C21H20N6O3S2 — CID 17334307
N-[[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-3,5-dimethoxybenzamide (PubChem CID 17334307) has the molecular formula C21H20N6O3S2 and a molecular weight of 468.56 g/mol. Its IUPAC name is N-[[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 17334307 |
| Molecular Formula | C21H20N6O3S2 |
| Molecular Weight | 468.56 g/mol |
| Exact Mass | 468.10 |
| IUPAC Name | N-[[3-(3-ethyl-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]-3,5-dimethoxybenzamide |
| SMILES | CCc1nnc2sc(-c3cccc(NC(=S)NC(=O)c4cc(OC)cc(OC)c4)c3)nn12 |
| InChI | InChI=1S/C21H20N6O3S2/c1-4-17-24-25-21-27(17)26-19(32-21)12-6-5-7-14(8-12)22-20(31)23-18(28)13-9-15(29-2)11-16(10-13)30-3/h5-11H,4H2,1-3H3,(H2,22,23,28,31) |
| InChIKey | WFGOENWJQUOWMT-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.56 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|