C19H16N6O3S2 — CID 4032843
3,5-dimethoxy-N-[[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide (PubChem CID 4032843) has the molecular formula C19H16N6O3S2 and a molecular weight of 440.51 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4032843 |
| Molecular Formula | C19H16N6O3S2 |
| Molecular Weight | 440.51 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 3,5-dimethoxy-N-[[4-([1,2,4]triazolo[3,4-b][1,3,4]thiadiazol-6-yl)phenyl]carbamothioyl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(=S)Nc2ccc(-c3nn4cnnc4s3)cc2)c1 |
| InChI | InChI=1S/C19H16N6O3S2/c1-27-14-7-12(8-15(9-14)28-2)16(26)22-18(29)21-13-5-3-11(4-6-13)17-24-25-10-20-23-19(25)30-17/h3-10H,1-2H3,(H2,21,22,26,29) |
| InChIKey | TUIUEQJDCORKBG-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 102.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.51 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|