C27H25N5O6S3 — CID 5215569
N-[[2-[(3,5-dimethoxybenzoyl)carbamothioylamino]-1,3-benzothiazol-6-yl]carbamothioyl]-3,5-dimethoxybenzamide (PubChem CID 5215569) has the molecular formula C27H25N5O6S3 and a molecular weight of 611.73 g/mol. Its IUPAC name is N-[[2-[(3,5-dimethoxybenzoyl)carbamothioylamino]-1,3-benzothiazol-6-yl]carbamothioyl]-3,5-dimethoxybenzamide.
| Compound Name | N-[[2-[(3,5-dimethoxybenzoyl)carbamothioylamino]-1,3-benzothiazol-6-yl]carbamothioyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 5215569 |
| Molecular Formula | C27H25N5O6S3 |
| Molecular Weight | 611.73 g/mol |
| Exact Mass | 611.10 |
| IUPAC Name | N-[[2-[(3,5-dimethoxybenzoyl)carbamothioylamino]-1,3-benzothiazol-6-yl]carbamothioyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)NC(=S)Nc2ccc3nc(NC(=S)NC(=O)c4cc(OC)cc(OC)c4)sc3c2)c1 |
| InChI | InChI=1S/C27H25N5O6S3/c1-35-17-7-14(8-18(12-17)36-2)23(33)30-25(39)28-16-5-6-21-22(11-16)41-27(29-21)32-26(40)31-24(34)15-9-19(37-3)13-20(10-15)38-4/h5-13H,1-4H3,(H2,28,30,33,39)(H2,29,31,32,34,40) |
| InChIKey | FQHIIHXTXSGJHA-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 132.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.73 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|