C20H20N4O3S2 — CID 22778881
N-[[2-(butanoylamino)-1,3-benzothiazol-6-yl]carbamothioyl]-3-methoxybenzamide (PubChem CID 22778881) has the molecular formula C20H20N4O3S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N-[[2-(butanoylamino)-1,3-benzothiazol-6-yl]carbamothioyl]-3-methoxybenzamide.
| Compound Name | N-[[2-(butanoylamino)-1,3-benzothiazol-6-yl]carbamothioyl]-3-methoxybenzamide |
|---|---|
| PubChem CID | 22778881 |
| Molecular Formula | C20H20N4O3S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | N-[[2-(butanoylamino)-1,3-benzothiazol-6-yl]carbamothioyl]-3-methoxybenzamide |
| SMILES | CCCC(=O)Nc1nc2ccc(NC(=S)NC(=O)c3cccc(OC)c3)cc2s1 |
| InChI | InChI=1S/C20H20N4O3S2/c1-3-5-17(25)23-20-22-15-9-8-13(11-16(15)29-20)21-19(28)24-18(26)12-6-4-7-14(10-12)27-2/h4,6-11H,3,5H2,1-2H3,(H,22,23,25)(H2,21,24,26,28) |
| InChIKey | XJCNHRRGBYFFLF-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|