C21H21N3O4S2 — CID 17127895
butyl 2-[(3-methoxybenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate (PubChem CID 17127895) has the molecular formula C21H21N3O4S2 and a molecular weight of 443.55 g/mol. Its IUPAC name is butyl 2-[(3-methoxybenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | butyl 2-[(3-methoxybenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 17127895 |
| Molecular Formula | C21H21N3O4S2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.10 |
| IUPAC Name | butyl 2-[(3-methoxybenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCOC(=O)c1ccc2nc(NC(=S)NC(=O)c3cccc(OC)c3)sc2c1 |
| InChI | InChI=1S/C21H21N3O4S2/c1-3-4-10-28-19(26)14-8-9-16-17(12-14)30-21(22-16)24-20(29)23-18(25)13-6-5-7-15(11-13)27-2/h5-9,11-12H,3-4,10H2,1-2H3,(H2,22,23,24,25,29) |
| InChIKey | NHIWRQCHFGJRAO-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|