C23H25N3O4S2 — CID 17127910
butyl 2-[(4-propan-2-yloxybenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate (PubChem CID 17127910) has the molecular formula C23H25N3O4S2 and a molecular weight of 471.60 g/mol. Its IUPAC name is butyl 2-[(4-propan-2-yloxybenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | butyl 2-[(4-propan-2-yloxybenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 17127910 |
| Molecular Formula | C23H25N3O4S2 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.13 |
| IUPAC Name | butyl 2-[(4-propan-2-yloxybenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCOC(=O)c1ccc2nc(NC(=S)NC(=O)c3ccc(OC(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C23H25N3O4S2/c1-4-5-12-29-21(28)16-8-11-18-19(13-16)32-23(24-18)26-22(31)25-20(27)15-6-9-17(10-7-15)30-14(2)3/h6-11,13-14H,4-5,12H2,1-3H3,(H2,24,25,26,27,31) |
| InChIKey | XXQVGCGZFGOGGL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|