C17H12BrN3O3S2 — CID 17128924
methyl 2-[(3-bromobenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate (PubChem CID 17128924) has the molecular formula C17H12BrN3O3S2 and a molecular weight of 450.34 g/mol. Its IUPAC name is methyl 2-[(3-bromobenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-[(3-bromobenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 17128924 |
| Molecular Formula | C17H12BrN3O3S2 |
| Molecular Weight | 450.34 g/mol |
| Exact Mass | 448.95 |
| IUPAC Name | methyl 2-[(3-bromobenzoyl)carbamothioylamino]-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1ccc2nc(NC(=S)NC(=O)c3cccc(Br)c3)sc2c1 |
| InChI | InChI=1S/C17H12BrN3O3S2/c1-24-15(23)10-5-6-12-13(8-10)26-17(19-12)21-16(25)20-14(22)9-3-2-4-11(18)7-9/h2-8H,1H3,(H2,19,20,21,22,25) |
| InChIKey | PBNGJEVPCWTGSK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.34 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|