C15H10BrN3OS2 — CID 46192848
N-[(5-bromo-1,3-benzothiazol-2-yl)carbamothioyl]benzamide (PubChem CID 46192848) has the molecular formula C15H10BrN3OS2 and a molecular weight of 392.30 g/mol. Its IUPAC name is N-[(5-bromo-1,3-benzothiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | N-[(5-bromo-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 46192848 |
| Molecular Formula | C15H10BrN3OS2 |
| Molecular Weight | 392.30 g/mol |
| Exact Mass | 390.94 |
| IUPAC Name | N-[(5-bromo-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1nc2cc(Br)ccc2s1)c1ccccc1 |
| InChI | InChI=1S/C15H10BrN3OS2/c16-10-6-7-12-11(8-10)17-15(22-12)19-14(21)18-13(20)9-4-2-1-3-5-9/h1-8H,(H2,17,18,19,20,21) |
| InChIKey | YRLAXTONUAHXJM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.30 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|