C22H17N3OS2 — CID 2905350
N-[(6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]-4-phenylbenzamide (PubChem CID 2905350) has the molecular formula C22H17N3OS2 and a molecular weight of 403.53 g/mol. Its IUPAC name is N-[(6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]-4-phenylbenzamide.
| Compound Name | N-[(6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 2905350 |
| Molecular Formula | C22H17N3OS2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.08 |
| IUPAC Name | N-[(6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]-4-phenylbenzamide |
| SMILES | Cc1ccc2nc(NC(=S)NC(=O)c3ccc(-c4ccccc4)cc3)sc2c1 |
| InChI | InChI=1S/C22H17N3OS2/c1-14-7-12-18-19(13-14)28-22(23-18)25-21(27)24-20(26)17-10-8-16(9-11-17)15-5-3-2-4-6-15/h2-13H,1H3,(H2,23,24,25,26,27) |
| InChIKey | YYUPLPJEJLXIGG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|