C20H21N3OS2 — CID 5175386
N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]-3-methylbenzamide (PubChem CID 5175386) has the molecular formula C20H21N3OS2 and a molecular weight of 383.54 g/mol. Its IUPAC name is N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]-3-methylbenzamide.
| Compound Name | N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 5175386 |
| Molecular Formula | C20H21N3OS2 |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]-3-methylbenzamide |
| SMILES | CCCCc1ccc2nc(NC(=S)NC(=O)c3cccc(C)c3)sc2c1 |
| InChI | InChI=1S/C20H21N3OS2/c1-3-4-7-14-9-10-16-17(12-14)26-20(21-16)23-19(25)22-18(24)15-8-5-6-13(2)11-15/h5-6,8-12H,3-4,7H2,1-2H3,(H2,21,22,23,24,25) |
| InChIKey | JOLUAKMWJJBKTJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|