C20H19N3O3S2 — CID 3256743
N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]-1,3-benzodioxole-5-carboxamide (PubChem CID 3256743) has the molecular formula C20H19N3O3S2 and a molecular weight of 413.52 g/mol. Its IUPAC name is N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 3256743 |
| Molecular Formula | C20H19N3O3S2 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]-1,3-benzodioxole-5-carboxamide |
| SMILES | CCCCc1ccc2nc(NC(=S)NC(=O)c3ccc4c(c3)OCO4)sc2c1 |
| InChI | InChI=1S/C20H19N3O3S2/c1-2-3-4-12-5-7-14-17(9-12)28-20(21-14)23-19(27)22-18(24)13-6-8-15-16(10-13)26-11-25-15/h5-10H,2-4,11H2,1H3,(H2,21,22,23,24,27) |
| InChIKey | NLDPBIGWDAWFSW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|