C17H17N3OS3 — CID 5175137
N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]thiophene-2-carboxamide (PubChem CID 5175137) has the molecular formula C17H17N3OS3 and a molecular weight of 375.54 g/mol. Its IUPAC name is N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]thiophene-2-carboxamide.
| Compound Name | N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 5175137 |
| Molecular Formula | C17H17N3OS3 |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.05 |
| IUPAC Name | N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]thiophene-2-carboxamide |
| SMILES | CCCCc1ccc2nc(NC(=S)NC(=O)c3cccs3)sc2c1 |
| InChI | InChI=1S/C17H17N3OS3/c1-2-3-5-11-7-8-12-14(10-11)24-17(18-12)20-16(22)19-15(21)13-6-4-9-23-13/h4,6-10H,2-3,5H2,1H3,(H2,18,19,20,21,22) |
| InChIKey | XJDAJVFGNGRGFY-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|