C19H18ClN3OS2 — CID 5188777
N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]-4-chlorobenzamide (PubChem CID 5188777) has the molecular formula C19H18ClN3OS2 and a molecular weight of 403.96 g/mol. Its IUPAC name is N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]-4-chlorobenzamide.
| Compound Name | N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]-4-chlorobenzamide |
|---|---|
| PubChem CID | 5188777 |
| Molecular Formula | C19H18ClN3OS2 |
| Molecular Weight | 403.96 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | N-[(6-butyl-1,3-benzothiazol-2-yl)carbamothioyl]-4-chlorobenzamide |
| SMILES | CCCCc1ccc2nc(NC(=S)NC(=O)c3ccc(Cl)cc3)sc2c1 |
| InChI | InChI=1S/C19H18ClN3OS2/c1-2-3-4-12-5-10-15-16(11-12)26-19(21-15)23-18(25)22-17(24)13-6-8-14(20)9-7-13/h5-11H,2-4H2,1H3,(H2,21,22,23,24,25) |
| InChIKey | XGFILINLWJHKDA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.96 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|