C22H23N3O2S2 — CID 58119282
4-tert-butyl-N-[[6-(2-oxopropyl)-1,3-benzothiazol-2-yl]carbamothioyl]benzamide (PubChem CID 58119282) has the molecular formula C22H23N3O2S2 and a molecular weight of 425.58 g/mol. Its IUPAC name is 4-tert-butyl-N-[[6-(2-oxopropyl)-1,3-benzothiazol-2-yl]carbamothioyl]benzamide.
| Compound Name | 4-tert-butyl-N-[[6-(2-oxopropyl)-1,3-benzothiazol-2-yl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 58119282 |
| Molecular Formula | C22H23N3O2S2 |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 4-tert-butyl-N-[[6-(2-oxopropyl)-1,3-benzothiazol-2-yl]carbamothioyl]benzamide |
| SMILES | CC(=O)Cc1ccc2nc(NC(=S)NC(=O)c3ccc(C(C)(C)C)cc3)sc2c1 |
| InChI | InChI=1S/C22H23N3O2S2/c1-13(26)11-14-5-10-17-18(12-14)29-21(23-17)25-20(28)24-19(27)15-6-8-16(9-7-15)22(2,3)4/h5-10,12H,11H2,1-4H3,(H2,23,24,25,27,28) |
| InChIKey | KTFIDXOWTXJMAL-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|