C19H18ClN3O2S2 — CID 4506792
3-butan-2-yloxy-N-[(6-chloro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide (PubChem CID 4506792) has the molecular formula C19H18ClN3O2S2 and a molecular weight of 419.96 g/mol. Its IUPAC name is 3-butan-2-yloxy-N-[(6-chloro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 3-butan-2-yloxy-N-[(6-chloro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4506792 |
| Molecular Formula | C19H18ClN3O2S2 |
| Molecular Weight | 419.96 g/mol |
| Exact Mass | 419.05 |
| IUPAC Name | 3-butan-2-yloxy-N-[(6-chloro-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
| SMILES | CCC(C)Oc1cccc(C(=O)NC(=S)Nc2nc3ccc(Cl)cc3s2)c1 |
| InChI | InChI=1S/C19H18ClN3O2S2/c1-3-11(2)25-14-6-4-5-12(9-14)17(24)22-18(26)23-19-21-15-8-7-13(20)10-16(15)27-19/h4-11H,3H2,1-2H3,(H2,21,22,23,24,26) |
| InChIKey | YCSPLZLNENJZOJ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.96 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|