C20H20ClN3O2S2 — CID 27235818
3-[(2R)-butan-2-yl]oxy-N-[(5-chloro-6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide (PubChem CID 27235818) has the molecular formula C20H20ClN3O2S2 and a molecular weight of 433.99 g/mol. Its IUPAC name is 3-[(2R)-butan-2-yl]oxy-N-[(5-chloro-6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide.
| Compound Name | 3-[(2R)-butan-2-yl]oxy-N-[(5-chloro-6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 27235818 |
| Molecular Formula | C20H20ClN3O2S2 |
| Molecular Weight | 433.99 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 3-[(2R)-butan-2-yl]oxy-N-[(5-chloro-6-methyl-1,3-benzothiazol-2-yl)carbamothioyl]benzamide |
| SMILES | CC[C@@H](C)Oc1cccc(C(=O)NC(=S)Nc2nc3cc(Cl)c(C)cc3s2)c1 |
| InChI | InChI=1S/C20H20ClN3O2S2/c1-4-12(3)26-14-7-5-6-13(9-14)18(25)23-19(27)24-20-22-16-10-15(21)11(2)8-17(16)28-20/h5-10,12H,4H2,1-3H3,(H2,22,23,24,25,27)/t12-/m1/s1 |
| InChIKey | CJMFBFMMQXIAKC-GFCCVEGCSA-N |
| XLogP | 5.56 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.99 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|