C18H16ClN3O3S2 — CID 3340646
N-[(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)carbamothioyl]-4-ethoxybenzamide (PubChem CID 3340646) has the molecular formula C18H16ClN3O3S2 and a molecular weight of 421.93 g/mol. Its IUPAC name is N-[(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)carbamothioyl]-4-ethoxybenzamide.
| Compound Name | N-[(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)carbamothioyl]-4-ethoxybenzamide |
|---|---|
| PubChem CID | 3340646 |
| Molecular Formula | C18H16ClN3O3S2 |
| Molecular Weight | 421.93 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | N-[(5-chloro-6-methoxy-1,3-benzothiazol-2-yl)carbamothioyl]-4-ethoxybenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2nc3cc(Cl)c(OC)cc3s2)cc1 |
| InChI | InChI=1S/C18H16ClN3O3S2/c1-3-25-11-6-4-10(5-7-11)16(23)21-17(26)22-18-20-13-8-12(19)14(24-2)9-15(13)27-18/h4-9H,3H2,1-2H3,(H2,20,21,22,23,26) |
| InChIKey | CZSBZUHKBXRQMB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.93 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|