C21H23N3O4S2 — CID 1339348
N-(1,3-benzothiazol-2-ylcarbamothioyl)-3,4,5-triethoxybenzamide (PubChem CID 1339348) has the molecular formula C21H23N3O4S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-ylcarbamothioyl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(1,3-benzothiazol-2-ylcarbamothioyl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 1339348 |
| Molecular Formula | C21H23N3O4S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-ylcarbamothioyl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2nc3ccccc3s2)cc(OCC)c1OCC |
| InChI | InChI=1S/C21H23N3O4S2/c1-4-26-15-11-13(12-16(27-5-2)18(15)28-6-3)19(25)23-20(29)24-21-22-14-9-7-8-10-17(14)30-21/h7-12H,4-6H2,1-3H3,(H2,22,23,24,25,29) |
| InChIKey | DUEJYIZNLBAMAY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 81.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|