C24H30N2O4S — CID 53268856
N-(6-tert-butyl-1,3-benzothiazol-2-yl)-3,4,5-triethoxybenzamide (PubChem CID 53268856) has the molecular formula C24H30N2O4S and a molecular weight of 442.58 g/mol. Its IUPAC name is N-(6-tert-butyl-1,3-benzothiazol-2-yl)-3,4,5-triethoxybenzamide.
| Compound Name | N-(6-tert-butyl-1,3-benzothiazol-2-yl)-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 53268856 |
| Molecular Formula | C24H30N2O4S |
| Molecular Weight | 442.58 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | N-(6-tert-butyl-1,3-benzothiazol-2-yl)-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)Nc2nc3ccc(C(C)(C)C)cc3s2)cc(OCC)c1OCC |
| InChI | InChI=1S/C24H30N2O4S/c1-7-28-18-12-15(13-19(29-8-2)21(18)30-9-3)22(27)26-23-25-17-11-10-16(24(4,5)6)14-20(17)31-23/h10-14H,7-9H2,1-6H3,(H,25,26,27) |
| InChIKey | LUMKJKBFIZARSI-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.58 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |