C21H24N2O3S — CID 53268881
N-(6-tert-butyl-1,3-benzothiazol-2-yl)-2-(2-ethoxyphenoxy)acetamide (PubChem CID 53268881) has the molecular formula C21H24N2O3S and a molecular weight of 384.50 g/mol. Its IUPAC name is N-(6-tert-butyl-1,3-benzothiazol-2-yl)-2-(2-ethoxyphenoxy)acetamide.
| Compound Name | N-(6-tert-butyl-1,3-benzothiazol-2-yl)-2-(2-ethoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 53268881 |
| Molecular Formula | C21H24N2O3S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.15 |
| IUPAC Name | N-(6-tert-butyl-1,3-benzothiazol-2-yl)-2-(2-ethoxyphenoxy)acetamide |
| SMILES | CCOc1ccccc1OCC(=O)Nc1nc2ccc(C(C)(C)C)cc2s1 |
| InChI | InChI=1S/C21H24N2O3S/c1-5-25-16-8-6-7-9-17(16)26-13-19(24)23-20-22-15-11-10-14(21(2,3)4)12-18(15)27-20/h6-12H,5,13H2,1-4H3,(H,22,23,24) |
| InChIKey | IAGFMPPGDLDGAM-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |