C19H20N2O3S — CID 1020058
2-(2,6-dimethylphenoxy)-N-(6-ethoxy-1,3-benzothiazol-2-yl)acetamide (PubChem CID 1020058) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-(2,6-dimethylphenoxy)-N-(6-ethoxy-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(2,6-dimethylphenoxy)-N-(6-ethoxy-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 1020058 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-(2,6-dimethylphenoxy)-N-(6-ethoxy-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CCOc1ccc2nc(NC(=O)COc3c(C)cccc3C)sc2c1 |
| InChI | InChI=1S/C19H20N2O3S/c1-4-23-14-8-9-15-16(10-14)25-19(20-15)21-17(22)11-24-18-12(2)6-5-7-13(18)3/h5-10H,4,11H2,1-3H3,(H,20,21,22) |
| InChIKey | CNLNDMMUBQUBQS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |