C23H28N2O4S — CID 41235435
3,4,5-triethoxy-N-(6-propan-2-yl-1,3-benzothiazol-2-yl)benzamide (PubChem CID 41235435) has the molecular formula C23H28N2O4S and a molecular weight of 428.55 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-(6-propan-2-yl-1,3-benzothiazol-2-yl)benzamide.
| Compound Name | 3,4,5-triethoxy-N-(6-propan-2-yl-1,3-benzothiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 41235435 |
| Molecular Formula | C23H28N2O4S |
| Molecular Weight | 428.55 g/mol |
| Exact Mass | 428.18 |
| IUPAC Name | 3,4,5-triethoxy-N-(6-propan-2-yl-1,3-benzothiazol-2-yl)benzamide |
| SMILES | CCOc1cc(C(=O)Nc2nc3ccc(C(C)C)cc3s2)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H28N2O4S/c1-6-27-18-11-16(12-19(28-7-2)21(18)29-8-3)22(26)25-23-24-17-10-9-15(14(4)5)13-20(17)30-23/h9-14H,6-8H2,1-5H3,(H,24,25,26) |
| InChIKey | WZONVCHWSZISIT-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.55 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |