C20H22Cl2N2O4S — CID 3561534
N-[(3,4-dichlorophenyl)carbamothioyl]-3,4,5-triethoxybenzamide (PubChem CID 3561534) has the molecular formula C20H22Cl2N2O4S and a molecular weight of 457.38 g/mol. Its IUPAC name is N-[(3,4-dichlorophenyl)carbamothioyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[(3,4-dichlorophenyl)carbamothioyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 3561534 |
| Molecular Formula | C20H22Cl2N2O4S |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | N-[(3,4-dichlorophenyl)carbamothioyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2ccc(Cl)c(Cl)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H22Cl2N2O4S/c1-4-26-16-9-12(10-17(27-5-2)18(16)28-6-3)19(25)24-20(29)23-13-7-8-14(21)15(22)11-13/h7-11H,4-6H2,1-3H3,(H2,23,24,25,29) |
| InChIKey | KWPFFSFYESNMGY-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|