C27H35ClN4O5S — CID 17317558
N-[[3-chloro-4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]-3,4,5-triethoxybenzamide (PubChem CID 17317558) has the molecular formula C27H35ClN4O5S and a molecular weight of 563.12 g/mol. Its IUPAC name is N-[[3-chloro-4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[[3-chloro-4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 17317558 |
| Molecular Formula | C27H35ClN4O5S |
| Molecular Weight | 563.12 g/mol |
| Exact Mass | 562.20 |
| IUPAC Name | N-[[3-chloro-4-(4-propanoylpiperazin-1-yl)phenyl]carbamothioyl]-3,4,5-triethoxybenzamide |
| SMILES | CCOc1cc(C(=O)NC(=S)Nc2ccc(N3CCN(C(=O)CC)CC3)c(Cl)c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C27H35ClN4O5S/c1-5-24(33)32-13-11-31(12-14-32)21-10-9-19(17-20(21)28)29-27(38)30-26(34)18-15-22(35-6-2)25(37-8-4)23(16-18)36-7-3/h9-10,15-17H,5-8,11-14H2,1-4H3,(H2,29,30,34,38) |
| InChIKey | AXFJEZCWXFMNMY-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.12 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|