C24H30ClN3O5S — CID 17115688
N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-3,4,5-triethoxybenzamide (PubChem CID 17115688) has the molecular formula C24H30ClN3O5S and a molecular weight of 508.04 g/mol. Its IUPAC name is N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-3,4,5-triethoxybenzamide.
| Compound Name | N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-3,4,5-triethoxybenzamide |
|---|---|
| PubChem CID | 17115688 |
| Molecular Formula | C24H30ClN3O5S |
| Molecular Weight | 508.04 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-3,4,5-triethoxybenzamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=S)NC(=O)c2cc(OCC)c(OCC)c(OCC)c2)c1 |
| InChI | InChI=1S/C24H30ClN3O5S/c1-5-9-21(29)26-16-10-11-17(25)18(14-16)27-24(34)28-23(30)15-12-19(31-6-2)22(33-8-4)20(13-15)32-7-3/h10-14H,5-9H2,1-4H3,(H,26,29)(H2,27,28,30,34) |
| InChIKey | USGYPYMMABLLME-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 97.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.04 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|