C18H17ClIN3O2S — CID 4510130
N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-2-iodobenzamide (PubChem CID 4510130) has the molecular formula C18H17ClIN3O2S and a molecular weight of 501.78 g/mol. Its IUPAC name is N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-2-iodobenzamide.
| Compound Name | N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 4510130 |
| Molecular Formula | C18H17ClIN3O2S |
| Molecular Weight | 501.78 g/mol |
| Exact Mass | 500.98 |
| IUPAC Name | N-[[5-(butanoylamino)-2-chlorophenyl]carbamothioyl]-2-iodobenzamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=S)NC(=O)c2ccccc2I)c1 |
| InChI | InChI=1S/C18H17ClIN3O2S/c1-2-5-16(24)21-11-8-9-13(19)15(10-11)22-18(26)23-17(25)12-6-3-4-7-14(12)20/h3-4,6-10H,2,5H2,1H3,(H,21,24)(H2,22,23,25,26) |
| InChIKey | DZXXVJNVFDSVDI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.78 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|