C18H16Cl3N3O3S — CID 17109734
3,5-dichloro-N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 17109734) has the molecular formula C18H16Cl3N3O3S and a molecular weight of 460.77 g/mol. Its IUPAC name is 3,5-dichloro-N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 17109734 |
| Molecular Formula | C18H16Cl3N3O3S |
| Molecular Weight | 460.77 g/mol |
| Exact Mass | 459.00 |
| IUPAC Name | 3,5-dichloro-N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | CCC(=O)Nc1ccc(Cl)c(NC(=S)NC(=O)c2cc(Cl)cc(Cl)c2OC)c1 |
| InChI | InChI=1S/C18H16Cl3N3O3S/c1-3-15(25)22-10-4-5-12(20)14(8-10)23-18(28)24-17(26)11-6-9(19)7-13(21)16(11)27-2/h4-8H,3H2,1-2H3,(H,22,25)(H2,23,24,26,28) |
| InChIKey | CGINPBNAQYRTNW-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.77 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|