C19H14Cl2N2O2S — CID 1048337
3,5-dichloro-2-methoxy-N-(naphthalen-1-ylcarbamothioyl)benzamide (PubChem CID 1048337) has the molecular formula C19H14Cl2N2O2S and a molecular weight of 405.31 g/mol. Its IUPAC name is 3,5-dichloro-2-methoxy-N-(naphthalen-1-ylcarbamothioyl)benzamide.
| Compound Name | 3,5-dichloro-2-methoxy-N-(naphthalen-1-ylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 1048337 |
| Molecular Formula | C19H14Cl2N2O2S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | 3,5-dichloro-2-methoxy-N-(naphthalen-1-ylcarbamothioyl)benzamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)NC(=S)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C19H14Cl2N2O2S/c1-25-17-14(9-12(20)10-15(17)21)18(24)23-19(26)22-16-8-4-6-11-5-2-3-7-13(11)16/h2-10H,1H3,(H2,22,23,24,26) |
| InChIKey | QPLFBWKWRDSGJR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|