C25H19Cl2N3O4S — CID 21214817
N-[4-[(3,5-dichloro-2-methoxybenzoyl)carbamothioylamino]-2-methylphenyl]-1-benzofuran-2-carboxamide (PubChem CID 21214817) has the molecular formula C25H19Cl2N3O4S and a molecular weight of 528.42 g/mol. Its IUPAC name is N-[4-[(3,5-dichloro-2-methoxybenzoyl)carbamothioylamino]-2-methylphenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[(3,5-dichloro-2-methoxybenzoyl)carbamothioylamino]-2-methylphenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21214817 |
| Molecular Formula | C25H19Cl2N3O4S |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | N-[4-[(3,5-dichloro-2-methoxybenzoyl)carbamothioylamino]-2-methylphenyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1c(Cl)cc(Cl)cc1C(=O)NC(=S)Nc1ccc(NC(=O)c2cc3ccccc3o2)c(C)c1 |
| InChI | InChI=1S/C25H19Cl2N3O4S/c1-13-9-16(28-25(35)30-23(31)17-11-15(26)12-18(27)22(17)33-2)7-8-19(13)29-24(32)21-10-14-5-3-4-6-20(14)34-21/h3-12H,1-2H3,(H,29,32)(H2,28,30,31,35) |
| InChIKey | WBIHHHXVBLJUET-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|