C25H20ClN3O4S — CID 21214827
N-[4-[(5-chloro-2-methoxybenzoyl)carbamothioylamino]-2-methylphenyl]-1-benzofuran-2-carboxamide (PubChem CID 21214827) has the molecular formula C25H20ClN3O4S and a molecular weight of 493.97 g/mol. Its IUPAC name is N-[4-[(5-chloro-2-methoxybenzoyl)carbamothioylamino]-2-methylphenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[(5-chloro-2-methoxybenzoyl)carbamothioylamino]-2-methylphenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21214827 |
| Molecular Formula | C25H20ClN3O4S |
| Molecular Weight | 493.97 g/mol |
| Exact Mass | 493.09 |
| IUPAC Name | N-[4-[(5-chloro-2-methoxybenzoyl)carbamothioylamino]-2-methylphenyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NC(=S)Nc1ccc(NC(=O)c2cc3ccccc3o2)c(C)c1 |
| InChI | InChI=1S/C25H20ClN3O4S/c1-14-11-17(27-25(34)29-23(30)18-13-16(26)7-10-21(18)32-2)8-9-19(14)28-24(31)22-12-15-5-3-4-6-20(15)33-22/h3-13H,1-2H3,(H,28,31)(H2,27,29,30,34) |
| InChIKey | HBVWZOIJGYDJAX-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.97 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|