C24H18IN3O4S — CID 3551770
N-[4-[(2-iodobenzoyl)carbamothioylamino]-2-methoxyphenyl]-1-benzofuran-2-carboxamide (PubChem CID 3551770) has the molecular formula C24H18IN3O4S and a molecular weight of 571.40 g/mol. Its IUPAC name is N-[4-[(2-iodobenzoyl)carbamothioylamino]-2-methoxyphenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[(2-iodobenzoyl)carbamothioylamino]-2-methoxyphenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 3551770 |
| Molecular Formula | C24H18IN3O4S |
| Molecular Weight | 571.40 g/mol |
| Exact Mass | 571.01 |
| IUPAC Name | N-[4-[(2-iodobenzoyl)carbamothioylamino]-2-methoxyphenyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc(NC(=S)NC(=O)c2ccccc2I)ccc1NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C24H18IN3O4S/c1-31-20-13-15(26-24(33)28-22(29)16-7-3-4-8-17(16)25)10-11-18(20)27-23(30)21-12-14-6-2-5-9-19(14)32-21/h2-13H,1H3,(H,27,30)(H2,26,28,29,33) |
| InChIKey | GSCKLMRIWJLFMF-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.40 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|