C24H17I2N3O3S — CID 21232936
N-[4-[(2,5-diiodobenzoyl)carbamothioylamino]-2-methylphenyl]-1-benzofuran-2-carboxamide (PubChem CID 21232936) has the molecular formula C24H17I2N3O3S and a molecular weight of 681.29 g/mol. Its IUPAC name is N-[4-[(2,5-diiodobenzoyl)carbamothioylamino]-2-methylphenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[(2,5-diiodobenzoyl)carbamothioylamino]-2-methylphenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21232936 |
| Molecular Formula | C24H17I2N3O3S |
| Molecular Weight | 681.29 g/mol |
| Exact Mass | 680.91 |
| IUPAC Name | N-[4-[(2,5-diiodobenzoyl)carbamothioylamino]-2-methylphenyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(NC(=S)NC(=O)c2cc(I)ccc2I)ccc1NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C24H17I2N3O3S/c1-13-10-16(27-24(33)29-22(30)17-12-15(25)6-8-18(17)26)7-9-19(13)28-23(31)21-11-14-4-2-3-5-20(14)32-21/h2-12H,1H3,(H,28,31)(H2,27,29,30,33) |
| InChIKey | XTEFLMVSTJXYOC-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.29 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|