C28H27N3O4S — CID 17112248
N-[2-methyl-4-[[3-(2-methylpropoxy)benzoyl]carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 17112248) has the molecular formula C28H27N3O4S and a molecular weight of 501.61 g/mol. Its IUPAC name is N-[2-methyl-4-[[3-(2-methylpropoxy)benzoyl]carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-methyl-4-[[3-(2-methylpropoxy)benzoyl]carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 17112248 |
| Molecular Formula | C28H27N3O4S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | N-[2-methyl-4-[[3-(2-methylpropoxy)benzoyl]carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(NC(=S)NC(=O)c2cccc(OCC(C)C)c2)ccc1NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C28H27N3O4S/c1-17(2)16-34-22-9-6-8-20(14-22)26(32)31-28(36)29-21-11-12-23(18(3)13-21)30-27(33)25-15-19-7-4-5-10-24(19)35-25/h4-15,17H,16H2,1-3H3,(H,30,33)(H2,29,31,32,36) |
| InChIKey | OOLDQOVXKMPEGV-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|