C25H20N4O5S — CID 21232957
N-[2-methyl-4-[(3-methyl-4-nitrobenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide (PubChem CID 21232957) has the molecular formula C25H20N4O5S and a molecular weight of 488.53 g/mol. Its IUPAC name is N-[2-methyl-4-[(3-methyl-4-nitrobenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[2-methyl-4-[(3-methyl-4-nitrobenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21232957 |
| Molecular Formula | C25H20N4O5S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | N-[2-methyl-4-[(3-methyl-4-nitrobenzoyl)carbamothioylamino]phenyl]-1-benzofuran-2-carboxamide |
| SMILES | Cc1cc(NC(=S)NC(=O)c2ccc([N+](=O)[O-])c(C)c2)ccc1NC(=O)c1cc2ccccc2o1 |
| InChI | InChI=1S/C25H20N4O5S/c1-14-12-18(26-25(35)28-23(30)17-7-10-20(29(32)33)15(2)11-17)8-9-19(14)27-24(31)22-13-16-5-3-4-6-21(16)34-22/h3-13H,1-2H3,(H,27,31)(H2,26,28,30,35) |
| InChIKey | KCCCVVIUVKXAAA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|