C28H22N2O4 — CID 21213329
N-[4-[(3-methoxynaphthalene-2-carbonyl)amino]-2-methylphenyl]-1-benzofuran-2-carboxamide (PubChem CID 21213329) has the molecular formula C28H22N2O4 and a molecular weight of 450.49 g/mol. Its IUPAC name is N-[4-[(3-methoxynaphthalene-2-carbonyl)amino]-2-methylphenyl]-1-benzofuran-2-carboxamide.
| Compound Name | N-[4-[(3-methoxynaphthalene-2-carbonyl)amino]-2-methylphenyl]-1-benzofuran-2-carboxamide |
|---|---|
| PubChem CID | 21213329 |
| Molecular Formula | C28H22N2O4 |
| Molecular Weight | 450.49 g/mol |
| Exact Mass | 450.16 |
| IUPAC Name | N-[4-[(3-methoxynaphthalene-2-carbonyl)amino]-2-methylphenyl]-1-benzofuran-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)Nc1ccc(NC(=O)c2cc3ccccc3o2)c(C)c1 |
| InChI | InChI=1S/C28H22N2O4/c1-17-13-21(29-27(31)22-14-18-7-3-4-8-19(18)15-25(22)33-2)11-12-23(17)30-28(32)26-16-20-9-5-6-10-24(20)34-26/h3-16H,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | KTFLNGMAFNDOIU-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.49 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |