C18H24ClN3O2S — CID 54786752
N-[4-chloro-3-[(2-cyclopentylacetyl)carbamothioylamino]phenyl]butanamide (PubChem CID 54786752) has the molecular formula C18H24ClN3O2S and a molecular weight of 381.93 g/mol. Its IUPAC name is N-[4-chloro-3-[(2-cyclopentylacetyl)carbamothioylamino]phenyl]butanamide.
| Compound Name | N-[4-chloro-3-[(2-cyclopentylacetyl)carbamothioylamino]phenyl]butanamide |
|---|---|
| PubChem CID | 54786752 |
| Molecular Formula | C18H24ClN3O2S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | N-[4-chloro-3-[(2-cyclopentylacetyl)carbamothioylamino]phenyl]butanamide |
| SMILES | CCCC(=O)Nc1ccc(Cl)c(NC(=S)NC(=O)CC2CCCC2)c1 |
| InChI | InChI=1S/C18H24ClN3O2S/c1-2-5-16(23)20-13-8-9-14(19)15(11-13)21-18(25)22-17(24)10-12-6-3-4-7-12/h8-9,11-12H,2-7,10H2,1H3,(H,20,23)(H2,21,22,24,25) |
| InChIKey | INDQIKKGRBRGBH-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|