C17H20ClF3N2OS — CID 54787017
N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-3-cyclohexylpropanamide (PubChem CID 54787017) has the molecular formula C17H20ClF3N2OS and a molecular weight of 392.87 g/mol. Its IUPAC name is N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-3-cyclohexylpropanamide.
| Compound Name | N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-3-cyclohexylpropanamide |
|---|---|
| PubChem CID | 54787017 |
| Molecular Formula | C17H20ClF3N2OS |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | N-[[2-chloro-5-(trifluoromethyl)phenyl]carbamothioyl]-3-cyclohexylpropanamide |
| SMILES | O=C(CCC1CCCCC1)NC(=S)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C17H20ClF3N2OS/c18-13-8-7-12(17(19,20)21)10-14(13)22-16(25)23-15(24)9-6-11-4-2-1-3-5-11/h7-8,10-11H,1-6,9H2,(H2,22,23,24,25) |
| InChIKey | HGAGDXTZFGQNRK-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|