C10H9ClF3N3OS — CID 22752085
1-acetamido-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea (PubChem CID 22752085) has the molecular formula C10H9ClF3N3OS and a molecular weight of 311.72 g/mol. Its IUPAC name is 1-acetamido-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-acetamido-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 22752085 |
| Molecular Formula | C10H9ClF3N3OS |
| Molecular Weight | 311.72 g/mol |
| Exact Mass | 311.01 |
| IUPAC Name | 1-acetamido-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea |
| SMILES | CC(=O)NNC(=S)Nc1cc(C(F)(F)F)ccc1Cl |
| InChI | InChI=1S/C10H9ClF3N3OS/c1-5(18)16-17-9(19)15-8-4-6(10(12,13)14)2-3-7(8)11/h2-4H,1H3,(H,16,18)(H2,15,17,19) |
| InChIKey | DWOIAHPFKCHEIF-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.72 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|