C16H15ClF3NO3 — CID 123991145
3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]-2-methylhepta-2,4-dienoic acid (PubChem CID 123991145) has the molecular formula C16H15ClF3NO3 and a molecular weight of 361.75 g/mol. Its IUPAC name is 3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]-2-methylhepta-2,4-dienoic acid.
| Compound Name | 3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]-2-methylhepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 123991145 |
| Molecular Formula | C16H15ClF3NO3 |
| Molecular Weight | 361.75 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 3-[[2-chloro-5-(trifluoromethyl)phenyl]carbamoyl]-2-methylhepta-2,4-dienoic acid |
| SMILES | CCC=CC(C(=O)Nc1cc(C(F)(F)F)ccc1Cl)=C(C)C(=O)O |
| InChI | InChI=1S/C16H15ClF3NO3/c1-3-4-5-11(9(2)15(23)24)14(22)21-13-8-10(16(18,19)20)6-7-12(13)17/h4-8H,3H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | QAIDSVKFGKHDMV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.75 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|