C11H7ClF3NO4 — CID 67452303
2-[[2-chloro-5-(trifluoromethyl)anilino]methylidene]propanedioic acid (PubChem CID 67452303) has the molecular formula C11H7ClF3NO4 and a molecular weight of 309.63 g/mol. Its IUPAC name is 2-[[2-chloro-5-(trifluoromethyl)anilino]methylidene]propanedioic acid.
| Compound Name | 2-[[2-chloro-5-(trifluoromethyl)anilino]methylidene]propanedioic acid |
|---|---|
| PubChem CID | 67452303 |
| Molecular Formula | C11H7ClF3NO4 |
| Molecular Weight | 309.63 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 2-[[2-chloro-5-(trifluoromethyl)anilino]methylidene]propanedioic acid |
| SMILES | O=C(O)C(=CNc1cc(C(F)(F)F)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H7ClF3NO4/c12-7-2-1-5(11(13,14)15)3-8(7)16-4-6(9(17)18)10(19)20/h1-4,16H,(H,17,18)(H,19,20) |
| InChIKey | QRBSASUJHKOGQT-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.63 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|