C17H13ClF3N3O2 — CID 3457721
N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-(1-phenylethylideneamino)oxamide (PubChem CID 3457721) has the molecular formula C17H13ClF3N3O2 and a molecular weight of 383.76 g/mol. Its IUPAC name is N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-(1-phenylethylideneamino)oxamide.
| Compound Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-(1-phenylethylideneamino)oxamide |
|---|---|
| PubChem CID | 3457721 |
| Molecular Formula | C17H13ClF3N3O2 |
| Molecular Weight | 383.76 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | N-[2-chloro-5-(trifluoromethyl)phenyl]-N'-(1-phenylethylideneamino)oxamide |
| SMILES | CC(=NNC(=O)C(=O)Nc1cc(C(F)(F)F)ccc1Cl)c1ccccc1 |
| InChI | InChI=1S/C17H13ClF3N3O2/c1-10(11-5-3-2-4-6-11)23-24-16(26)15(25)22-14-9-12(17(19,20)21)7-8-13(14)18/h2-9H,1H3,(H,22,25)(H,24,26) |
| InChIKey | GJUYVZHMVUDAOV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.76 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|