C17H12ClF3N4S — CID 6038260
1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-1-(4-cyanophenyl)ethylideneamino]thiourea (PubChem CID 6038260) has the molecular formula C17H12ClF3N4S and a molecular weight of 396.83 g/mol. Its IUPAC name is 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-1-(4-cyanophenyl)ethylideneamino]thiourea.
| Compound Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-1-(4-cyanophenyl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 6038260 |
| Molecular Formula | C17H12ClF3N4S |
| Molecular Weight | 396.83 g/mol |
| Exact Mass | 396.04 |
| IUPAC Name | 1-[2-chloro-5-(trifluoromethyl)phenyl]-3-[(Z)-1-(4-cyanophenyl)ethylideneamino]thiourea |
| SMILES | C/C(=N/NC(=S)Nc1cc(C(F)(F)F)ccc1Cl)c1ccc(C#N)cc1 |
| InChI | InChI=1S/C17H12ClF3N4S/c1-10(12-4-2-11(9-22)3-5-12)24-25-16(26)23-15-8-13(17(19,20)21)6-7-14(15)18/h2-8H,1H3,(H2,23,25,26)/b24-10- |
| InChIKey | HSOZKYZKTUWYJQ-VROXFSQNSA-N |
| XLogP | 4.94 |
| TPSA | 60.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.83 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|