C16H14ClF3N4S — CID 18290324
1-[(E)-1-(3-aminophenyl)ethylideneamino]-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea (PubChem CID 18290324) has the molecular formula C16H14ClF3N4S and a molecular weight of 386.83 g/mol. Its IUPAC name is 1-[(E)-1-(3-aminophenyl)ethylideneamino]-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea.
| Compound Name | 1-[(E)-1-(3-aminophenyl)ethylideneamino]-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea |
|---|---|
| PubChem CID | 18290324 |
| Molecular Formula | C16H14ClF3N4S |
| Molecular Weight | 386.83 g/mol |
| Exact Mass | 386.06 |
| IUPAC Name | 1-[(E)-1-(3-aminophenyl)ethylideneamino]-3-[2-chloro-5-(trifluoromethyl)phenyl]thiourea |
| SMILES | C/C(=N\NC(=S)Nc1cc(C(F)(F)F)ccc1Cl)c1cccc(N)c1 |
| InChI | InChI=1S/C16H14ClF3N4S/c1-9(10-3-2-4-12(21)7-10)23-24-15(25)22-14-8-11(16(18,19)20)5-6-13(14)17/h2-8H,21H2,1H3,(H2,22,24,25)/b23-9+ |
| InChIKey | VTAROYZQNGLPKQ-NUGSKGIGSA-N |
| XLogP | 4.65 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.83 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|