C15H15FN4S — CID 7933653
1-[(Z)-1-(3-aminophenyl)ethylideneamino]-3-(2-fluorophenyl)thiourea (PubChem CID 7933653) has the molecular formula C15H15FN4S and a molecular weight of 302.38 g/mol. Its IUPAC name is 1-[(Z)-1-(3-aminophenyl)ethylideneamino]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[(Z)-1-(3-aminophenyl)ethylideneamino]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 7933653 |
| Molecular Formula | C15H15FN4S |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | 1-[(Z)-1-(3-aminophenyl)ethylideneamino]-3-(2-fluorophenyl)thiourea |
| SMILES | C/C(=N/NC(=S)Nc1ccccc1F)c1cccc(N)c1 |
| InChI | InChI=1S/C15H15FN4S/c1-10(11-5-4-6-12(17)9-11)19-20-15(21)18-14-8-3-2-7-13(14)16/h2-9H,17H2,1H3,(H2,18,20,21)/b19-10- |
| InChIKey | RXVPWFVGWSVZCD-GRSHGNNSSA-N |
| XLogP | 3.12 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|