C15H12ClFN4O2S — CID 7933632
1-[(Z)-1-(4-chloro-3-nitrophenyl)ethylideneamino]-3-(2-fluorophenyl)thiourea (PubChem CID 7933632) has the molecular formula C15H12ClFN4O2S and a molecular weight of 366.81 g/mol. Its IUPAC name is 1-[(Z)-1-(4-chloro-3-nitrophenyl)ethylideneamino]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[(Z)-1-(4-chloro-3-nitrophenyl)ethylideneamino]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 7933632 |
| Molecular Formula | C15H12ClFN4O2S |
| Molecular Weight | 366.81 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | 1-[(Z)-1-(4-chloro-3-nitrophenyl)ethylideneamino]-3-(2-fluorophenyl)thiourea |
| SMILES | C/C(=N/NC(=S)Nc1ccccc1F)c1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12ClFN4O2S/c1-9(10-6-7-11(16)14(8-10)21(22)23)19-20-15(24)18-13-5-3-2-4-12(13)17/h2-8H,1H3,(H2,18,20,24)/b19-9- |
| InChIKey | GYDKFLNBKPPYGZ-OCKHKDLRSA-N |
| XLogP | 4.10 |
| TPSA | 79.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.81 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|