C19H15Cl2N3S — CID 7407265
1-(2,4-dichlorophenyl)-3-[(E)-1-naphthalen-2-ylethylideneamino]thiourea (PubChem CID 7407265) has the molecular formula C19H15Cl2N3S and a molecular weight of 388.32 g/mol. Its IUPAC name is 1-(2,4-dichlorophenyl)-3-[(E)-1-naphthalen-2-ylethylideneamino]thiourea.
| Compound Name | 1-(2,4-dichlorophenyl)-3-[(E)-1-naphthalen-2-ylethylideneamino]thiourea |
|---|---|
| PubChem CID | 7407265 |
| Molecular Formula | C19H15Cl2N3S |
| Molecular Weight | 388.32 g/mol |
| Exact Mass | 387.04 |
| IUPAC Name | 1-(2,4-dichlorophenyl)-3-[(E)-1-naphthalen-2-ylethylideneamino]thiourea |
| SMILES | C/C(=N\NC(=S)Nc1ccc(Cl)cc1Cl)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H15Cl2N3S/c1-12(14-7-6-13-4-2-3-5-15(13)10-14)23-24-19(25)22-18-9-8-16(20)11-17(18)21/h2-11H,1H3,(H2,22,24,25)/b23-12+ |
| InChIKey | UUFCDQIULQQIPQ-FSJBWODESA-N |
| XLogP | 5.86 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.32 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hzone_naphth_A(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|