About manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride
manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride (PubChem CID 10474226) has the molecular formula C13H13Cl2MnN3S
and a molecular weight of 369.18 g/mol. Its IUPAC name is manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride.
Molecular Properties
| Compound Name | manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride |
| PubChem CID | 10474226 |
| Molecular Formula | C13H13Cl2MnN3S |
| Molecular Weight | 369.18 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride |
| SMILES | C/C(=N\NC(N)=S)c1ccc2ccccc2c1.[Cl-].[Cl-].[Mn+2] |
| InChI | InChI=1S/C13H13N3S.2ClH.Mn/c1-9(15-16-13(14)17)11-7-6-10-4-2-3-5-12(10)8-11;;;/h2-8H,1H3,(H3,14,16,17);2*1H;/q;;;+2/p-2/b15-9+;;; |
| InChIKey | WUAMNFGVSCWXFV-SFRYUHGMSA-L |
| XLogP | -3.60 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.18 |
| LogP ≤ 5 | -3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hzone_naphth_A(5)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride?
The IUPAC name of manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride (CID 10474226) is manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride.
What is the SMILES notation for manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride?
The canonical SMILES for manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride is C/C(=N\NC(N)=S)c1ccc2ccccc2c1.[Cl-].[Cl-].[Mn+2].
What is the InChIKey of manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride?
The InChIKey is WUAMNFGVSCWXFV-SFRYUHGMSA-L. The full InChI is InChI=1S/C13H13N3S.2ClH.Mn/c1-9(15-16-13(14)17)11-7-6-10-4-2-3-5-12(10)8-11;;;/h2-8H,1H3,(H3,14,16,17);2*1H;/q;;;+2/p-2/b15-9+;;;.
What are the key properties of manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride?
manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride has a molecular weight of 369.18 g/mol, XLogP of -3.60, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);[(E)-1-naphthalen-2-ylethylideneamino]thiourea;dichloride is sourced from PubChem (CID 10474226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).