C11H15N3O2S — CID 5355637
[(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]thiourea (PubChem CID 5355637) has the molecular formula C11H15N3O2S and a molecular weight of 253.33 g/mol. Its IUPAC name is [(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]thiourea.
| Compound Name | [(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]thiourea |
|---|---|
| PubChem CID | 5355637 |
| Molecular Formula | C11H15N3O2S |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | [(Z)-1-(3,4-dimethoxyphenyl)ethylideneamino]thiourea |
| SMILES | COc1ccc(/C(C)=N\NC(N)=S)cc1OC |
| InChI | InChI=1S/C11H15N3O2S/c1-7(13-14-11(12)17)8-4-5-9(15-2)10(6-8)16-3/h4-6H,1-3H3,(H3,12,14,17)/b13-7- |
| InChIKey | IQLBAZRLMZKISH-QPEQYQDCSA-N |
| XLogP | 1.26 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|