C13H18N6S — CID 166735098
[(E)-1-[4-[(E)-N-(1-aminoethenylamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]thiourea (PubChem CID 166735098) has the molecular formula C13H18N6S and a molecular weight of 290.40 g/mol. Its IUPAC name is [(E)-1-[4-[(E)-N-(1-aminoethenylamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]thiourea.
| Compound Name | [(E)-1-[4-[(E)-N-(1-aminoethenylamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]thiourea |
|---|---|
| PubChem CID | 166735098 |
| Molecular Formula | C13H18N6S |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | [(E)-1-[4-[(E)-N-(1-aminoethenylamino)-C-methylcarbonimidoyl]phenyl]ethylideneamino]thiourea |
| SMILES | C=C(N)N/N=C(\C)c1ccc(/C(C)=N/NC(N)=S)cc1 |
| InChI | InChI=1S/C13H18N6S/c1-8(16-18-10(3)14)11-4-6-12(7-5-11)9(2)17-19-13(15)20/h4-7,18H,3,14H2,1-2H3,(H3,15,19,20)/b16-8+,17-9+ |
| InChIKey | IXZJCRVCJODPDP-GONBZBRSSA-N |
| XLogP | 0.99 |
| TPSA | 100.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|