C13H17N3O4S — CID 4994062
4-(carbamothioylhydrazinylidene)-4-(3,4-dimethoxyphenyl)butanoic acid (PubChem CID 4994062) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 4-(carbamothioylhydrazinylidene)-4-(3,4-dimethoxyphenyl)butanoic acid.
| Compound Name | 4-(carbamothioylhydrazinylidene)-4-(3,4-dimethoxyphenyl)butanoic acid |
|---|---|
| PubChem CID | 4994062 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-(carbamothioylhydrazinylidene)-4-(3,4-dimethoxyphenyl)butanoic acid |
| SMILES | COc1ccc(C(CCC(=O)O)=NNC(N)=S)cc1OC |
| InChI | InChI=1S/C13H17N3O4S/c1-19-10-5-3-8(7-11(10)20-2)9(4-6-12(17)18)15-16-13(14)21/h3,5,7H,4,6H2,1-2H3,(H,17,18)(H3,14,16,21) |
| InChIKey | CMBJLKJDTYLXPK-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 106.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|